C22H27N5O7 — CID 59947612
(3S)-3-[[(10S)-1,5-dioxo-2-(3-phenylpropanoylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59947612) has the molecular formula C22H27N5O7 and a molecular weight of 473.49 g/mol. Its IUPAC name is (3S)-3-[[(10S)-1,5-dioxo-2-(3-phenylpropanoylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(10S)-1,5-dioxo-2-(3-phenylpropanoylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59947612 |
| Molecular Formula | C22H27N5O7 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (3S)-3-[[(10S)-1,5-dioxo-2-(3-phenylpropanoylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN2C(=O)CCN(NC(=O)CCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C22H27N5O7/c28-14-16(13-20(31)32)23-21(33)17-7-4-11-26-19(30)10-12-25(22(34)27(17)26)24-18(29)9-8-15-5-2-1-3-6-15/h1-3,5-6,14,16-17H,4,7-13H2,(H,23,33)(H,24,29)(H,31,32)/t16-,17-/m0/s1 |
| InChIKey | LGGOOSSPISSUSZ-IRXDYDNUSA-N |
| XLogP | -0.16 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|