C19H23N5O8S — CID 59947637
(3S)-3-[[(10S)-2-(benzenesulfonamido)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59947637) has the molecular formula C19H23N5O8S and a molecular weight of 481.49 g/mol. Its IUPAC name is (3S)-3-[[(10S)-2-(benzenesulfonamido)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(10S)-2-(benzenesulfonamido)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59947637 |
| Molecular Formula | C19H23N5O8S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (3S)-3-[[(10S)-2-(benzenesulfonamido)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN2C(=O)CCN(NS(=O)(=O)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C19H23N5O8S/c25-12-13(11-17(27)28)20-18(29)15-7-4-9-23-16(26)8-10-22(19(30)24(15)23)21-33(31,32)14-5-2-1-3-6-14/h1-3,5-6,12-13,15,21H,4,7-11H2,(H,20,29)(H,27,28)/t13-,15-/m0/s1 |
| InChIKey | DHGQHHWIRQZBQS-ZFWWWQNUSA-N |
| XLogP | -0.93 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|