C23H27N5O10 — CID 22954794
3-[[2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954794) has the molecular formula C23H27N5O10 and a molecular weight of 533.49 g/mol. Its IUPAC name is 3-[[2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954794 |
| Molecular Formula | C23H27N5O10 |
| Molecular Weight | 533.49 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 3-[[2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | COc1cccc(OC)c1C(=O)C(=O)NN1CCC(=O)N2CCCC(C(=O)NC(C=O)CC(=O)O)N2C1=O |
| InChI | InChI=1S/C23H27N5O10/c1-37-15-6-3-7-16(38-2)19(15)20(33)22(35)25-26-10-8-17(30)27-9-4-5-14(28(27)23(26)36)21(34)24-13(12-29)11-18(31)32/h3,6-7,12-14H,4-5,8-11H2,1-2H3,(H,24,34)(H,25,35)(H,31,32) |
| InChIKey | DUQJNOYRNXMWHC-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 191.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.49 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|