C23H29N5O10 — CID 22954745
3-[[1,5-dioxo-2-[(3,4,5-trimethoxybenzoyl)amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954745) has the molecular formula C23H29N5O10 and a molecular weight of 535.51 g/mol. Its IUPAC name is 3-[[1,5-dioxo-2-[(3,4,5-trimethoxybenzoyl)amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1,5-dioxo-2-[(3,4,5-trimethoxybenzoyl)amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954745 |
| Molecular Formula | C23H29N5O10 |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 3-[[1,5-dioxo-2-[(3,4,5-trimethoxybenzoyl)amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | COc1cc(C(=O)NN2CCC(=O)N3CCCC(C(=O)NC(C=O)CC(=O)O)N3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H29N5O10/c1-36-16-9-13(10-17(37-2)20(16)38-3)21(33)25-26-8-6-18(30)27-7-4-5-15(28(27)23(26)35)22(34)24-14(12-29)11-19(31)32/h9-10,12,14-15H,4-8,11H2,1-3H3,(H,24,34)(H,25,33)(H,31,32) |
| InChIKey | PHDSBDFABJFYFN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 184.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|