C20H21F2N5O7 — CID 59947450
(3S)-3-[[(10S)-2-[(3,4-difluorobenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59947450) has the molecular formula C20H21F2N5O7 and a molecular weight of 481.41 g/mol. Its IUPAC name is (3S)-3-[[(10S)-2-[(3,4-difluorobenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(10S)-2-[(3,4-difluorobenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59947450 |
| Molecular Formula | C20H21F2N5O7 |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (3S)-3-[[(10S)-2-[(3,4-difluorobenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN2C(=O)CCN(NC(=O)c3ccc(F)c(F)c3)C(=O)N12 |
| InChI | InChI=1S/C20H21F2N5O7/c21-13-4-3-11(8-14(13)22)18(32)24-25-7-5-16(29)26-6-1-2-15(27(26)20(25)34)19(33)23-12(10-28)9-17(30)31/h3-4,8,10,12,15H,1-2,5-7,9H2,(H,23,33)(H,24,32)(H,30,31)/t12-,15-/m0/s1 |
| InChIKey | BXRJTFLWMABNLB-WFASDCNBSA-N |
| XLogP | -0.20 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|