C21H24N6O9 — CID 58357203
3-[[2-[[4-(carboxyamino)benzoyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 58357203) has the molecular formula C21H24N6O9 and a molecular weight of 504.46 g/mol. Its IUPAC name is 3-[[2-[[4-(carboxyamino)benzoyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[4-(carboxyamino)benzoyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58357203 |
| Molecular Formula | C21H24N6O9 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 3-[[2-[[4-(carboxyamino)benzoyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)c3ccc(NC(=O)O)cc3)C(=O)N12 |
| InChI | InChI=1S/C21H24N6O9/c28-11-14(10-17(30)31)22-19(33)15-2-1-8-26-16(29)7-9-25(21(36)27(15)26)24-18(32)12-3-5-13(6-4-12)23-20(34)35/h3-6,11,14-15,23H,1-2,7-10H2,(H,22,33)(H,24,32)(H,30,31)(H,34,35) |
| InChIKey | ONVKUODHSVNQHP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|