C21H25N5O8 — CID 22954855
3-[[2-[(3-methoxybenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954855) has the molecular formula C21H25N5O8 and a molecular weight of 475.46 g/mol. Its IUPAC name is 3-[[2-[(3-methoxybenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(3-methoxybenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954855 |
| Molecular Formula | C21H25N5O8 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-[[2-[(3-methoxybenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | COc1cccc(C(=O)NN2CCC(=O)N3CCCC(C(=O)NC(C=O)CC(=O)O)N3C2=O)c1 |
| InChI | InChI=1S/C21H25N5O8/c1-34-15-5-2-4-13(10-15)19(31)23-24-9-7-17(28)25-8-3-6-16(26(25)21(24)33)20(32)22-14(12-27)11-18(29)30/h2,4-5,10,12,14,16H,3,6-9,11H2,1H3,(H,22,32)(H,23,31)(H,29,30) |
| InChIKey | IBXVCVADSHSUGC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 165.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|