C23H28N6O8 — CID 22954755
3-[[1,5-dioxo-2-[[4-(propanoylamino)benzoyl]amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954755) has the molecular formula C23H28N6O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is 3-[[1,5-dioxo-2-[[4-(propanoylamino)benzoyl]amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1,5-dioxo-2-[[4-(propanoylamino)benzoyl]amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954755 |
| Molecular Formula | C23H28N6O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 3-[[1,5-dioxo-2-[[4-(propanoylamino)benzoyl]amino]-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CCC(=O)Nc1ccc(C(=O)NN2CCC(=O)N3CCCC(C(=O)NC(C=O)CC(=O)O)N3C2=O)cc1 |
| InChI | InChI=1S/C23H28N6O8/c1-2-18(31)24-15-7-5-14(6-8-15)21(35)26-27-11-9-19(32)28-10-3-4-17(29(28)23(27)37)22(36)25-16(13-30)12-20(33)34/h5-8,13,16-17H,2-4,9-12H2,1H3,(H,24,31)(H,25,36)(H,26,35)(H,33,34) |
| InChIKey | JXKZSFBSSRQWLY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 185.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|