C21H25N5O6 — CID 22955098
2-benzamido-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 22955098) has the molecular formula C21H25N5O6 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-benzamido-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | 2-benzamido-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 22955098 |
| Molecular Formula | C21H25N5O6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-benzamido-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | CC(=O)CC(C=O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C21H25N5O6/c1-14(28)12-16(13-27)22-20(31)17-8-5-10-25-18(29)9-11-24(21(32)26(17)25)23-19(30)15-6-3-2-4-7-15/h2-4,6-7,13,16-17H,5,8-12H2,1H3,(H,22,31)(H,23,30) |
| InChIKey | JNTIISRWTAIHLI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|