C23H26N6O6 — CID 22955217
N-(1,4-dioxopentan-2-yl)-2-(1H-indole-2-carbonylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 22955217) has the molecular formula C23H26N6O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is N-(1,4-dioxopentan-2-yl)-2-(1H-indole-2-carbonylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | N-(1,4-dioxopentan-2-yl)-2-(1H-indole-2-carbonylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 22955217 |
| Molecular Formula | C23H26N6O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-(1,4-dioxopentan-2-yl)-2-(1H-indole-2-carbonylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | CC(=O)CC(C=O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)c3cc4ccccc4[nH]3)C(=O)N12 |
| InChI | InChI=1S/C23H26N6O6/c1-14(31)11-16(13-30)24-22(34)19-7-4-9-28-20(32)8-10-27(23(35)29(19)28)26-21(33)18-12-15-5-2-3-6-17(15)25-18/h2-3,5-6,12-13,16,19,25H,4,7-11H2,1H3,(H,24,34)(H,26,33) |
| InChIKey | HWQBPTBYUKQCEE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 151.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|