C23H24N6O7 — CID 22954762
3-[[1,5-dioxo-2-(quinoline-3-carbonylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954762) has the molecular formula C23H24N6O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is 3-[[1,5-dioxo-2-(quinoline-3-carbonylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1,5-dioxo-2-(quinoline-3-carbonylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954762 |
| Molecular Formula | C23H24N6O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 3-[[1,5-dioxo-2-(quinoline-3-carbonylamino)-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)c3cnc4ccccc4c3)C(=O)N12 |
| InChI | InChI=1S/C23H24N6O7/c30-13-16(11-20(32)33)25-22(35)18-6-3-8-28-19(31)7-9-27(23(36)29(18)28)26-21(34)15-10-14-4-1-2-5-17(14)24-12-15/h1-2,4-5,10,12-13,16,18H,3,6-9,11H2,(H,25,35)(H,26,34)(H,32,33) |
| InChIKey | ZJLDFMQKDSFRPX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|