C23H35N5O6 — CID 59960925
(10S)-2-(3-cyclohexylpropanoylamino)-N-[(2S)-1,4-dioxopentan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 59960925) has the molecular formula C23H35N5O6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (10S)-2-(3-cyclohexylpropanoylamino)-N-[(2S)-1,4-dioxopentan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | (10S)-2-(3-cyclohexylpropanoylamino)-N-[(2S)-1,4-dioxopentan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 59960925 |
| Molecular Formula | C23H35N5O6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (10S)-2-(3-cyclohexylpropanoylamino)-N-[(2S)-1,4-dioxopentan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)[C@@H]1CCCN2C(=O)CCN(NC(=O)CCC3CCCCC3)C(=O)N12 |
| InChI | InChI=1S/C23H35N5O6/c1-16(30)14-18(15-29)24-22(33)19-8-5-12-27-21(32)11-13-26(23(34)28(19)27)25-20(31)10-9-17-6-3-2-4-7-17/h15,17-19H,2-14H2,1H3,(H,24,33)(H,25,31)/t18-,19-/m0/s1 |
| InChIKey | MHPTVZMNBFSXKI-OALUTQOASA-N |
| XLogP | 1.07 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|