C23H25N5O9 — CID 22955060
2-[[2-(1,3-benzodioxol-5-yl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 22955060) has the molecular formula C23H25N5O9 and a molecular weight of 515.48 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 22955060 |
| Molecular Formula | C23H25N5O9 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | CC(=O)CC(C=O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)C(=O)c3ccc4c(c3)OCO4)C(=O)N12 |
| InChI | InChI=1S/C23H25N5O9/c1-13(30)9-15(11-29)24-21(33)16-3-2-7-27-19(31)6-8-26(23(35)28(16)27)25-22(34)20(32)14-4-5-17-18(10-14)37-12-36-17/h4-5,10-11,15-16H,2-3,6-9,12H2,1H3,(H,24,33)(H,25,34) |
| InChIKey | AKGAYPOMMNVATF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|