C22H28N6O7 — CID 22955221
N-(1,4-dioxopentan-2-yl)-2-[(2-methoxyphenyl)carbamoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 22955221) has the molecular formula C22H28N6O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is N-(1,4-dioxopentan-2-yl)-2-[(2-methoxyphenyl)carbamoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | N-(1,4-dioxopentan-2-yl)-2-[(2-methoxyphenyl)carbamoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 22955221 |
| Molecular Formula | C22H28N6O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-(1,4-dioxopentan-2-yl)-2-[(2-methoxyphenyl)carbamoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | COc1ccccc1NC(=O)NN1CCC(=O)N2CCCC(C(=O)NC(C=O)CC(C)=O)N2C1=O |
| InChI | InChI=1S/C22H28N6O7/c1-14(30)12-15(13-29)23-20(32)17-7-5-10-27-19(31)9-11-26(22(34)28(17)27)25-21(33)24-16-6-3-4-8-18(16)35-2/h3-4,6,8,13,15,17H,5,7,9-12H2,1-2H3,(H,23,32)(H2,24,25,33) |
| InChIKey | VYGZOZOAMDTVJC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|