C21H24ClN5O7 — CID 59947803
(3S)-3-[[(10S)-2-[(3-chloro-2-methylbenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59947803) has the molecular formula C21H24ClN5O7 and a molecular weight of 493.90 g/mol. Its IUPAC name is (3S)-3-[[(10S)-2-[(3-chloro-2-methylbenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(10S)-2-[(3-chloro-2-methylbenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59947803 |
| Molecular Formula | C21H24ClN5O7 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | (3S)-3-[[(10S)-2-[(3-chloro-2-methylbenzoyl)amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | Cc1c(Cl)cccc1C(=O)NN1CCC(=O)N2CCC[C@@H](C(=O)N[C@H](C=O)CC(=O)O)N2C1=O |
| InChI | InChI=1S/C21H24ClN5O7/c1-12-14(4-2-5-15(12)22)19(32)24-25-9-7-17(29)26-8-3-6-16(27(26)21(25)34)20(33)23-13(11-28)10-18(30)31/h2,4-5,11,13,16H,3,6-10H2,1H3,(H,23,33)(H,24,32)(H,30,31)/t13-,16-/m0/s1 |
| InChIKey | HGIVMSIITUJIQB-BBRMVZONSA-N |
| XLogP | 0.49 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|