C24H29N5O9 — CID 22955055
2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 22955055) has the molecular formula C24H29N5O9 and a molecular weight of 531.52 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | 2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 22955055 |
| Molecular Formula | C24H29N5O9 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 2-[[2-(2,6-dimethoxyphenyl)-2-oxoacetyl]amino]-N-(1,4-dioxopentan-2-yl)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | COc1cccc(OC)c1C(=O)C(=O)NN1CCC(=O)N2CCCC(C(=O)NC(C=O)CC(C)=O)N2C1=O |
| InChI | InChI=1S/C24H29N5O9/c1-14(31)12-15(13-30)25-22(34)16-6-5-10-28-19(32)9-11-27(24(36)29(16)28)26-23(35)21(33)20-17(37-2)7-4-8-18(20)38-3/h4,7-8,13,15-16H,5-6,9-12H2,1-3H3,(H,25,34)(H,26,35) |
| InChIKey | INKCMQHCUSHIDY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|