C23H24N6O8 — CID 20670246
3-[[2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 20670246) has the molecular formula C23H24N6O8 and a molecular weight of 512.48 g/mol. Its IUPAC name is 3-[[2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20670246 |
| Molecular Formula | C23H24N6O8 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 3-[[2-[[2-(1H-indol-3-yl)-2-oxoacetyl]amino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)C(=O)c3c[nH]c4ccccc34)C(=O)N12 |
| InChI | InChI=1S/C23H24N6O8/c30-12-13(10-19(32)33)25-21(35)17-6-3-8-28-18(31)7-9-27(23(37)29(17)28)26-22(36)20(34)15-11-24-16-5-2-1-4-14(15)16/h1-2,4-5,11-13,17,24H,3,6-10H2,(H,25,35)(H,26,36)(H,32,33) |
| InChIKey | NUNPEEAVONNVAR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 189.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|