C22H33N5O7 — CID 22954842
3-[[2-(3-cyclohexylpropanoylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22954842) has the molecular formula C22H33N5O7 and a molecular weight of 479.53 g/mol. Its IUPAC name is 3-[[2-(3-cyclohexylpropanoylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-(3-cyclohexylpropanoylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22954842 |
| Molecular Formula | C22H33N5O7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 3-[[2-(3-cyclohexylpropanoylamino)-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CCCN2C(=O)CCN(NC(=O)CCC3CCCCC3)C(=O)N12 |
| InChI | InChI=1S/C22H33N5O7/c28-14-16(13-20(31)32)23-21(33)17-7-4-11-26-19(30)10-12-25(22(34)27(17)26)24-18(29)9-8-15-5-2-1-3-6-15/h14-17H,1-13H2,(H,23,33)(H,24,29)(H,31,32) |
| InChIKey | JCCXJQCIPFHKPJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|