C20H23N3O8 — CID 22977631
3-[[1-[2-(1,3-benzodioxole-5-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22977631) has the molecular formula C20H23N3O8 and a molecular weight of 433.42 g/mol. Its IUPAC name is 3-[[1-[2-(1,3-benzodioxole-5-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1-[2-(1,3-benzodioxole-5-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22977631 |
| Molecular Formula | C20H23N3O8 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 3-[[1-[2-(1,3-benzodioxole-5-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)c1ccc2c(c1)OCO2)C(=O)N1CCCC1C(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C20H23N3O8/c1-11(21-18(27)12-4-5-15-16(7-12)31-10-30-15)20(29)23-6-2-3-14(23)19(28)22-13(9-24)8-17(25)26/h4-5,7,9,11,13-14H,2-3,6,8,10H2,1H3,(H,21,27)(H,22,28)(H,25,26) |
| InChIKey | HDICHMXMOUWECT-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|