C22H27ClN4O7 — CID 89001725
3-[[(2S)-1-[(2S)-2-[[3-chloro-4-(propanoylamino)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 89001725) has the molecular formula C22H27ClN4O7 and a molecular weight of 494.93 g/mol. Its IUPAC name is 3-[[(2S)-1-[(2S)-2-[[3-chloro-4-(propanoylamino)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[(2S)-1-[(2S)-2-[[3-chloro-4-(propanoylamino)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89001725 |
| Molecular Formula | C22H27ClN4O7 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-[[(2S)-1-[(2S)-2-[[3-chloro-4-(propanoylamino)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CCC(=O)Nc1ccc(C(=O)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)NC(C=O)CC(=O)O)cc1Cl |
| InChI | InChI=1S/C22H27ClN4O7/c1-3-18(29)26-16-7-6-13(9-15(16)23)20(32)24-12(2)22(34)27-8-4-5-17(27)21(33)25-14(11-28)10-19(30)31/h6-7,9,11-12,14,17H,3-5,8,10H2,1-2H3,(H,24,32)(H,25,33)(H,26,29)(H,30,31)/t12-,14?,17-/m0/s1 |
| InChIKey | FKQQCAMOYKFRML-XTIDWKMFSA-N |
| XLogP | 0.96 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|