C19H21Cl2N3O7 — CID 59043754
(3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59043754) has the molecular formula C19H21Cl2N3O7 and a molecular weight of 474.30 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59043754 |
| Molecular Formula | C19H21Cl2N3O7 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)c1cc(Cl)c(O)c(Cl)c1)C(=O)N1CCCC1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C19H21Cl2N3O7/c1-9(22-17(29)10-5-12(20)16(28)13(21)6-10)19(31)24-4-2-3-14(24)18(30)23-11(8-25)7-15(26)27/h5-6,8-9,11,14,28H,2-4,7H2,1H3,(H,22,29)(H,23,30)(H,26,27)/t9-,11-,14?/m0/s1 |
| InChIKey | QDBLBOLXMYAVCK-PEVUIOCQSA-N |
| XLogP | 0.97 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|