C23H25N3O6 — CID 89001866
(3S)-3-[[1-[(2S)-2-(naphthalene-1-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 89001866) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S)-2-(naphthalene-1-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-[(2S)-2-(naphthalene-1-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89001866 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (3S)-3-[[1-[(2S)-2-(naphthalene-1-carbonylamino)propanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc2ccccc12)C(=O)N1CCCC1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C23H25N3O6/c1-14(24-21(30)18-9-4-7-15-6-2-3-8-17(15)18)23(32)26-11-5-10-19(26)22(31)25-16(13-27)12-20(28)29/h2-4,6-9,13-14,16,19H,5,10-12H2,1H3,(H,24,30)(H,25,31)(H,28,29)/t14-,16-,19?/m0/s1 |
| InChIKey | PVQWILCAQOZFNU-QAQDEBIESA-N |
| XLogP | 1.11 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|