C23H26N4O6 — CID 22977658
3-[[1-[2-(isoquinoline-1-carbonylamino)propanoyl]piperidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 22977658) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[[1-[2-(isoquinoline-1-carbonylamino)propanoyl]piperidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[1-[2-(isoquinoline-1-carbonylamino)propanoyl]piperidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22977658 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-[[1-[2-(isoquinoline-1-carbonylamino)propanoyl]piperidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)c1nccc2ccccc12)C(=O)N1CCCCC1C(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C23H26N4O6/c1-14(25-22(32)20-17-7-3-2-6-15(17)9-10-24-20)23(33)27-11-5-4-8-18(27)21(31)26-16(13-28)12-19(29)30/h2-3,6-7,9-10,13-14,16,18H,4-5,8,11-12H2,1H3,(H,25,32)(H,26,31)(H,29,30) |
| InChIKey | GICVEIYAIHJKFH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|