C20H23Cl2N3O7 — CID 89206384
(3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 89206384) has the molecular formula C20H23Cl2N3O7 and a molecular weight of 488.32 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89206384 |
| Molecular Formula | C20H23Cl2N3O7 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (3S)-3-[[1-[(2S)-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]butanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | CC[C@H](NC(=O)c1cc(Cl)c(O)c(Cl)c1)C(=O)N1CCCC1C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C20H23Cl2N3O7/c1-2-14(24-18(30)10-6-12(21)17(29)13(22)7-10)20(32)25-5-3-4-15(25)19(31)23-11(9-26)8-16(27)28/h6-7,9,11,14-15,29H,2-5,8H2,1H3,(H,23,31)(H,24,30)(H,27,28)/t11-,14-,15?/m0/s1 |
| InChIKey | FHAWVKQZPDCHFI-NRHGISANSA-N |
| XLogP | 1.36 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|