C22H27ClN4O6 — CID 89001898
(2S)-1-[(2S)-2-[(4-acetamido-3-chlorobenzoyl)amino]propanoyl]-N-(4-hydroxy-1-oxopent-4-en-2-yl)pyrrolidine-2-carboxamide (PubChem CID 89001898) has the molecular formula C22H27ClN4O6 and a molecular weight of 478.93 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(4-acetamido-3-chlorobenzoyl)amino]propanoyl]-N-(4-hydroxy-1-oxopent-4-en-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[(4-acetamido-3-chlorobenzoyl)amino]propanoyl]-N-(4-hydroxy-1-oxopent-4-en-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89001898 |
| Molecular Formula | C22H27ClN4O6 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | (2S)-1-[(2S)-2-[(4-acetamido-3-chlorobenzoyl)amino]propanoyl]-N-(4-hydroxy-1-oxopent-4-en-2-yl)pyrrolidine-2-carboxamide |
| SMILES | C=C(O)CC(C=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)c1ccc(NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN4O6/c1-12(29)9-16(11-28)26-21(32)19-5-4-8-27(19)22(33)13(2)24-20(31)15-6-7-18(17(23)10-15)25-14(3)30/h6-7,10-11,13,16,19,29H,1,4-5,8-9H2,2-3H3,(H,24,31)(H,25,30)(H,26,32)/t13-,16?,19-/m0/s1 |
| InChIKey | BCTGGOLJSNDBGW-BHPDKXSNSA-N |
| XLogP | 1.55 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|