C23H25N5O9 — CID 91092855
(3S)-3-[[(10S)-2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 91092855) has the molecular formula C23H25N5O9 and a molecular weight of 515.48 g/mol. Its IUPAC name is (3S)-3-[[(10S)-2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(10S)-2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91092855 |
| Molecular Formula | C23H25N5O9 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | (3S)-3-[[(10S)-2-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN2C(=O)CCN(NC(=O)C=Cc3ccc4c(c3)OCO4)C(=O)N12 |
| InChI | InChI=1S/C23H25N5O9/c29-12-15(11-21(32)33)24-22(34)16-2-1-8-27-20(31)7-9-26(23(35)28(16)27)25-19(30)6-4-14-3-5-17-18(10-14)37-13-36-17/h3-6,10,12,15-16H,1-2,7-9,11,13H2,(H,24,34)(H,25,30)(H,32,33)/t15-,16-/m0/s1 |
| InChIKey | BPFQNWKQZPONQL-HOTGVXAUSA-N |
| XLogP | -0.35 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|