C23H28N4O6 — CID 54039467
(3R,6S)-N-[(2S)-1,4-dioxopentan-2-yl]-1,4-dioxo-3-(3-phenylpropanoylamino)-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxamide (PubChem CID 54039467) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is (3R,6S)-N-[(2S)-1,4-dioxopentan-2-yl]-1,4-dioxo-3-(3-phenylpropanoylamino)-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxamide.
| Compound Name | (3R,6S)-N-[(2S)-1,4-dioxopentan-2-yl]-1,4-dioxo-3-(3-phenylpropanoylamino)-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 54039467 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3R,6S)-N-[(2S)-1,4-dioxopentan-2-yl]-1,4-dioxo-3-(3-phenylpropanoylamino)-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)[C@@H]1CCCN2C(=O)C[C@@H](NC(=O)CCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C23H28N4O6/c1-15(29)12-17(14-28)24-22(32)19-8-5-11-26-21(31)13-18(23(33)27(19)26)25-20(30)10-9-16-6-3-2-4-7-16/h2-4,6-7,14,17-19H,5,8-13H2,1H3,(H,24,32)(H,25,30)/t17-,18+,19-/m0/s1 |
| InChIKey | LLHXONKGSYZXRQ-OTWHNJEPSA-N |
| XLogP | -0.09 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|