C22H26ClN5O6 — CID 59961024
(4S,7S)-7-[(4-amino-3-chlorobenzoyl)amino]-N-[(2S)-1,4-dioxopentan-2-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide (PubChem CID 59961024) has the molecular formula C22H26ClN5O6 and a molecular weight of 491.93 g/mol. Its IUPAC name is (4S,7S)-7-[(4-amino-3-chlorobenzoyl)amino]-N-[(2S)-1,4-dioxopentan-2-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide.
| Compound Name | (4S,7S)-7-[(4-amino-3-chlorobenzoyl)amino]-N-[(2S)-1,4-dioxopentan-2-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 59961024 |
| Molecular Formula | C22H26ClN5O6 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (4S,7S)-7-[(4-amino-3-chlorobenzoyl)amino]-N-[(2S)-1,4-dioxopentan-2-yl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxamide |
| SMILES | CC(=O)C[C@@H](C=O)NC(=O)[C@@H]1CCCN2C(=O)CC[C@H](NC(=O)c3ccc(N)c(Cl)c3)C(=O)N12 |
| InChI | InChI=1S/C22H26ClN5O6/c1-12(30)9-14(11-29)25-21(33)18-3-2-8-27-19(31)7-6-17(22(34)28(18)27)26-20(32)13-4-5-16(24)15(23)10-13/h4-5,10-11,14,17-18H,2-3,6-9,24H2,1H3,(H,25,33)(H,26,32)/t14-,17-,18-/m0/s1 |
| InChIKey | AFMOHVZYHJPKOW-WBAXXEDZSA-N |
| XLogP | 0.21 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|