C22H24N6O7 — CID 58357213
3-[[7-(3H-indazole-5-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 58357213) has the molecular formula C22H24N6O7 and a molecular weight of 484.47 g/mol. Its IUPAC name is 3-[[7-(3H-indazole-5-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-[[7-(3H-indazole-5-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58357213 |
| Molecular Formula | C22H24N6O7 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[[7-(3H-indazole-5-carbonylamino)-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NC(=O)C1CCCN2C(=O)CCC(NC(=O)c3ccc4c(c3)CN=N4)C(=O)N12 |
| InChI | InChI=1S/C22H24N6O7/c29-11-14(9-19(31)32)24-21(34)17-2-1-7-27-18(30)6-5-16(22(35)28(17)27)25-20(33)12-3-4-15-13(8-12)10-23-26-15/h3-4,8,11,14,16-17H,1-2,5-7,9-10H2,(H,24,34)(H,25,33)(H,31,32) |
| InChIKey | TZLPAFAWNXCMEE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 177.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|