C28H34BrN3O6 — CID 70394140
(4S,7S)-7-[[(2S)-1-ethoxy-1-oxo-4-(4-phenylphenyl)butan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid;hydrobromide (PubChem CID 70394140) has the molecular formula C28H34BrN3O6 and a molecular weight of 588.50 g/mol. Its IUPAC name is (4S,7S)-7-[[(2S)-1-ethoxy-1-oxo-4-(4-phenylphenyl)butan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid;hydrobromide.
| Compound Name | (4S,7S)-7-[[(2S)-1-ethoxy-1-oxo-4-(4-phenylphenyl)butan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid;hydrobromide |
|---|---|
| PubChem CID | 70394140 |
| Molecular Formula | C28H34BrN3O6 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | (4S,7S)-7-[[(2S)-1-ethoxy-1-oxo-4-(4-phenylphenyl)butan-2-yl]amino]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid;hydrobromide |
| SMILES | Br.CCOC(=O)[C@H](CCc1ccc(-c2ccccc2)cc1)N[C@H]1CCC(=O)N2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C28H33N3O6.BrH/c1-2-37-28(36)23(15-12-19-10-13-21(14-11-19)20-7-4-3-5-8-20)29-22-16-17-25(32)30-18-6-9-24(27(34)35)31(30)26(22)33;/h3-5,7-8,10-11,13-14,22-24,29H,2,6,9,12,15-18H2,1H3,(H,34,35);1H/t22-,23-,24-;/m0./s1 |
| InChIKey | LHKABENCKJAKSD-NYTZCTPBSA-N |
| XLogP | 3.37 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |