C18H24N3O7P — CID 18597429
(3S,6S)-1,4-dioxo-3-[[(1R)-3-phenyl-1-phosphonopropyl]amino]-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid (PubChem CID 18597429) has the molecular formula C18H24N3O7P and a molecular weight of 425.38 g/mol. Its IUPAC name is (3S,6S)-1,4-dioxo-3-[[(1R)-3-phenyl-1-phosphonopropyl]amino]-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid.
| Compound Name | (3S,6S)-1,4-dioxo-3-[[(1R)-3-phenyl-1-phosphonopropyl]amino]-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid |
|---|---|
| PubChem CID | 18597429 |
| Molecular Formula | C18H24N3O7P |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (3S,6S)-1,4-dioxo-3-[[(1R)-3-phenyl-1-phosphonopropyl]amino]-2,3,6,7,8,9-hexahydropyridazino[1,2-a]pyridazine-6-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN2C(=O)C[C@H](N[C@@H](CCc3ccccc3)P(=O)(O)O)C(=O)N12 |
| InChI | InChI=1S/C18H24N3O7P/c22-16-11-13(17(23)21-14(18(24)25)7-4-10-20(16)21)19-15(29(26,27)28)9-8-12-5-2-1-3-6-12/h1-3,5-6,13-15,19H,4,7-11H2,(H,24,25)(H2,26,27,28)/t13-,14-,15+/m0/s1 |
| InChIKey | SEOHVJOZOMTNRU-SOUVJXGZSA-N |
| XLogP | 0.30 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|