C18H23N2O6P — CID 22838112
(4S,7S)-7-[hydroxy(2-phenylethyl)phosphoryl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid (PubChem CID 22838112) has the molecular formula C18H23N2O6P and a molecular weight of 394.36 g/mol. Its IUPAC name is (4S,7S)-7-[hydroxy(2-phenylethyl)phosphoryl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid.
| Compound Name | (4S,7S)-7-[hydroxy(2-phenylethyl)phosphoryl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 22838112 |
| Molecular Formula | C18H23N2O6P |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (4S,7S)-7-[hydroxy(2-phenylethyl)phosphoryl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN2C(=O)CC[C@H](P(=O)(O)CCc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C18H23N2O6P/c21-16-9-8-15(27(25,26)12-10-13-5-2-1-3-6-13)17(22)20-14(18(23)24)7-4-11-19(16)20/h1-3,5-6,14-15H,4,7-12H2,(H,23,24)(H,25,26)/t14-,15-/m0/s1 |
| InChIKey | MXXMVKUXPMJJLM-GJZGRUSLSA-N |
| XLogP | 1.48 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|