C15H25N2O7P — CID 22838120
methyl (4S,7S)-7-diethoxyphosphoryl-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 22838120) has the molecular formula C15H25N2O7P and a molecular weight of 376.35 g/mol. Its IUPAC name is methyl (4S,7S)-7-diethoxyphosphoryl-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | methyl (4S,7S)-7-diethoxyphosphoryl-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 22838120 |
| Molecular Formula | C15H25N2O7P |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl (4S,7S)-7-diethoxyphosphoryl-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCOP(=O)(OCC)[C@H]1CCC(=O)N2CCC[C@@H](C(=O)OC)N2C1=O |
| InChI | InChI=1S/C15H25N2O7P/c1-4-23-25(21,24-5-2)12-8-9-13(18)16-10-6-7-11(15(20)22-3)17(16)14(12)19/h11-12H,4-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | ZDHDHFIBWWJHFZ-RYUDHWBXSA-N |
| XLogP | 1.32 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|