C10H15N3O4 — CID 59960958
(10S)-10-acetyl-2-hydroxy-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-1,5-dione (PubChem CID 59960958) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (10S)-10-acetyl-2-hydroxy-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-1,5-dione.
| Compound Name | (10S)-10-acetyl-2-hydroxy-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-1,5-dione |
|---|---|
| PubChem CID | 59960958 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (10S)-10-acetyl-2-hydroxy-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-1,5-dione |
| SMILES | CC(=O)[C@@H]1CCCN2C(=O)CCN(O)C(=O)N12 |
| InChI | InChI=1S/C10H15N3O4/c1-7(14)8-3-2-5-11-9(15)4-6-12(17)10(16)13(8)11/h8,17H,2-6H2,1H3/t8-/m0/s1 |
| InChIKey | KQWHXUJZYLIPMM-QMMMGPOBSA-N |
| XLogP | -0.00 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|