C18H28N2O5S — CID 14300229
tert-butyl 7-(acetylsulfanylmethyl)-6,11-dioxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazocine-4-carboxylate (PubChem CID 14300229) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is tert-butyl 7-(acetylsulfanylmethyl)-6,11-dioxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazocine-4-carboxylate.
| Compound Name | tert-butyl 7-(acetylsulfanylmethyl)-6,11-dioxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazocine-4-carboxylate |
|---|---|
| PubChem CID | 14300229 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl 7-(acetylsulfanylmethyl)-6,11-dioxo-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazocine-4-carboxylate |
| SMILES | CC(=O)SCC1CCCC(=O)N2CCCC(C(=O)OC(C)(C)C)N2C1=O |
| InChI | InChI=1S/C18H28N2O5S/c1-12(21)26-11-13-7-5-9-15(22)19-10-6-8-14(20(19)16(13)23)17(24)25-18(2,3)4/h13-14H,5-11H2,1-4H3 |
| InChIKey | YSYSUWXOIWLXDA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|