C17H31NO2 — CID 115537695
tert-butyl (2R)-1-(2-ethylcyclohexyl)pyrrolidine-2-carboxylate (PubChem CID 115537695) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is tert-butyl (2R)-1-(2-ethylcyclohexyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-(2-ethylcyclohexyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537695 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | tert-butyl (2R)-1-(2-ethylcyclohexyl)pyrrolidine-2-carboxylate |
| SMILES | CCC1CCCCC1N1CCC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO2/c1-5-13-9-6-7-10-14(13)18-12-8-11-15(18)16(19)20-17(2,3)4/h13-15H,5-12H2,1-4H3/t13?,14?,15-/m1/s1 |
| InChIKey | HJBTWAKICLJPQW-YMAMQOFZSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |