C16H29NO2 — CID 115537275
tert-butyl (2S)-1-(4-methylcyclohexyl)pyrrolidine-2-carboxylate (PubChem CID 115537275) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl (2S)-1-(4-methylcyclohexyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(4-methylcyclohexyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537275 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl (2S)-1-(4-methylcyclohexyl)pyrrolidine-2-carboxylate |
| SMILES | CC1CCC(N2CCC[C@H]2C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO2/c1-12-7-9-13(10-8-12)17-11-5-6-14(17)15(18)19-16(2,3)4/h12-14H,5-11H2,1-4H3/t12?,13?,14-/m0/s1 |
| InChIKey | CIYOPDUMQNRTFT-RUXDESIVSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |