C16H29NO3 — CID 115537264
tert-butyl (2S)-1-(3-methoxycyclohexyl)pyrrolidine-2-carboxylate (PubChem CID 115537264) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl (2S)-1-(3-methoxycyclohexyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(3-methoxycyclohexyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115537264 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl (2S)-1-(3-methoxycyclohexyl)pyrrolidine-2-carboxylate |
| SMILES | COC1CCCC(N2CCC[C@H]2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H29NO3/c1-16(2,3)20-15(18)14-9-6-10-17(14)12-7-5-8-13(11-12)19-4/h12-14H,5-11H2,1-4H3/t12?,13?,14-/m0/s1 |
| InChIKey | FOJUODQZNMTSGN-RUXDESIVSA-N |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |