C10H19N3O2 — CID 145080399
(8S)-8-acetyl-2,3,4,6,7,8-hexahydropyrazolo[1,2-a][1,2,4]triazin-1-one;ethane (PubChem CID 145080399) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is (8S)-8-acetyl-2,3,4,6,7,8-hexahydropyrazolo[1,2-a][1,2,4]triazin-1-one;ethane.
| Compound Name | (8S)-8-acetyl-2,3,4,6,7,8-hexahydropyrazolo[1,2-a][1,2,4]triazin-1-one;ethane |
|---|---|
| PubChem CID | 145080399 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (8S)-8-acetyl-2,3,4,6,7,8-hexahydropyrazolo[1,2-a][1,2,4]triazin-1-one;ethane |
| SMILES | CC.CC(=O)[C@@H]1CCN2CCNC(=O)N12 |
| InChI | InChI=1S/C8H13N3O2.C2H6/c1-6(12)7-2-4-10-5-3-9-8(13)11(7)10;1-2/h7H,2-5H2,1H3,(H,9,13);1-2H3/t7-;/m0./s1 |
| InChIKey | YSIFTLQOCJJVNL-FJXQXJEOSA-N |
| XLogP | 0.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |