About (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate
(2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate (PubChem CID 175211358) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate |
| PubChem CID | 175211358 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)ON1CCNC1=O |
| InChI | InChI=1S/C8H12N2O3/c1-3-6(2)7(11)13-10-5-4-9-8(10)12/h3H,4-5H2,1-2H3,(H,9,12) |
| InChIKey | UKHHHANWNDKJJW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate?
The IUPAC name of (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate (CID 175211358) is (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate.
What is the SMILES notation for (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate?
The canonical SMILES for (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate is CC=C(C)C(=O)ON1CCNC1=O.
What is the InChIKey of (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate?
The InChIKey is UKHHHANWNDKJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-3-6(2)7(11)13-10-5-4-9-8(10)12/h3H,4-5H2,1-2H3,(H,9,12).
What are the key properties of (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate?
(2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate has a molecular weight of 184.19 g/mol, XLogP of 0.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoimidazolidin-1-yl) 2-methylbut-2-enoate is sourced from PubChem (CID 175211358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).