C13H19NO2 — CID 101417632
(7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-yl) (Z)-2-methylbut-2-enoate (PubChem CID 101417632) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-yl) (Z)-2-methylbut-2-enoate.
| Compound Name | (7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-yl) (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101417632 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-yl) (Z)-2-methylbut-2-enoate |
| SMILES | C=C1CCN2CCC(OC(=O)/C(C)=C\C)C12 |
| InChI | InChI=1S/C13H19NO2/c1-4-9(2)13(15)16-11-6-8-14-7-5-10(3)12(11)14/h4,11-12H,3,5-8H2,1-2H3/b9-4- |
| InChIKey | DUWDHZAOPSTHFG-WTKPLQERSA-N |
| XLogP | 1.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|