C15H22O6 — CID 51693869
[(2S,3R)-2-[(E,3S,4R)-3,4-dihydroxypent-1-enyl]-6-oxooxan-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 51693869) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is [(2S,3R)-2-[(E,3S,4R)-3,4-dihydroxypent-1-enyl]-6-oxooxan-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(2S,3R)-2-[(E,3S,4R)-3,4-dihydroxypent-1-enyl]-6-oxooxan-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 51693869 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [(2S,3R)-2-[(E,3S,4R)-3,4-dihydroxypent-1-enyl]-6-oxooxan-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1CCC(=O)O[C@H]1/C=C/[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C15H22O6/c1-4-9(2)15(19)21-13-7-8-14(18)20-12(13)6-5-11(17)10(3)16/h4-6,10-13,16-17H,7-8H2,1-3H3/b6-5+,9-4+/t10-,11+,12+,13-/m1/s1 |
| InChIKey | WEDIEMBZPFJDNC-SUJFCXGUSA-N |
| XLogP | 0.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|