About 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate
4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate (PubChem CID 90690513) has the molecular formula C10H12O6
and a molecular weight of 228.20 g/mol. Its IUPAC name is 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate.
Molecular Properties
| Compound Name | 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate |
| PubChem CID | 90690513 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate |
| SMILES | COC(=O)C=C(C)C(=O)OC1CCC(=O)O1 |
| InChI | InChI=1S/C10H12O6/c1-6(5-8(12)14-2)10(13)16-9-4-3-7(11)15-9/h5,9H,3-4H2,1-2H3 |
| InChIKey | ZCBSATWPLDZWNL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate?
The IUPAC name of 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate (CID 90690513) is 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate.
What is the SMILES notation for 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate?
The canonical SMILES for 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate is COC(=O)C=C(C)C(=O)OC1CCC(=O)O1.
What is the InChIKey of 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate?
The InChIKey is ZCBSATWPLDZWNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6/c1-6(5-8(12)14-2)10(13)16-9-4-3-7(11)15-9/h5,9H,3-4H2,1-2H3.
What are the key properties of 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate?
4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate has a molecular weight of 228.20 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-methyl 1-O-(5-oxooxolan-2-yl) 2-methylbut-2-enedioate is sourced from PubChem (CID 90690513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).