About (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate
(5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate (PubChem CID 90840017) has the molecular formula C8H9FO4
and a molecular weight of 188.15 g/mol. Its IUPAC name is (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate |
| PubChem CID | 90840017 |
| Molecular Formula | C8H9FO4 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate |
| SMILES | CC(=CF)C(=O)OC1CCC(=O)O1 |
| InChI | InChI=1S/C8H9FO4/c1-5(4-9)8(11)13-7-3-2-6(10)12-7/h4,7H,2-3H2,1H3 |
| InChIKey | NSUBLNGFYFWTGT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate?
The IUPAC name of (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate (CID 90840017) is (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate.
What is the SMILES notation for (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate?
The canonical SMILES for (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate is CC(=CF)C(=O)OC1CCC(=O)O1.
What is the InChIKey of (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate?
The InChIKey is NSUBLNGFYFWTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO4/c1-5(4-9)8(11)13-7-3-2-6(10)12-7/h4,7H,2-3H2,1H3.
What are the key properties of (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate?
(5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate has a molecular weight of 188.15 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxooxolan-2-yl) 3-fluoro-2-methylprop-2-enoate is sourced from PubChem (CID 90840017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).