C18H27NO5 — CID 91746536
[(1S,7R)-7-[(E)-2-methylbut-2-enoyl]oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (E)-4-hydroxy-3-methylbut-2-enoate (PubChem CID 91746536) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(1S,7R)-7-[(E)-2-methylbut-2-enoyl]oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (E)-4-hydroxy-3-methylbut-2-enoate.
| Compound Name | [(1S,7R)-7-[(E)-2-methylbut-2-enoyl]oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (E)-4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 91746536 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [(1S,7R)-7-[(E)-2-methylbut-2-enoyl]oxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl (E)-4-hydroxy-3-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1CCN2CC[C@H](COC(=O)/C=C(\C)CO)C12 |
| InChI | InChI=1S/C18H27NO5/c1-4-13(3)18(22)24-15-6-8-19-7-5-14(17(15)19)11-23-16(21)9-12(2)10-20/h4,9,14-15,17,20H,5-8,10-11H2,1-3H3/b12-9+,13-4+/t14-,15-,17?/m1/s1 |
| InChIKey | RMZXQFIAWAQDCT-WVYUHWAZSA-N |
| XLogP | 1.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|