About (2-oxoimidazolidin-1-yl) carbonochloridate
(2-oxoimidazolidin-1-yl) carbonochloridate (PubChem CID 88752032) has the molecular formula C4H5ClN2O3
and a molecular weight of 164.55 g/mol. Its IUPAC name is (2-oxoimidazolidin-1-yl) carbonochloridate.
Molecular Properties
| Compound Name | (2-oxoimidazolidin-1-yl) carbonochloridate |
| PubChem CID | 88752032 |
| Molecular Formula | C4H5ClN2O3 |
| Molecular Weight | 164.55 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | (2-oxoimidazolidin-1-yl) carbonochloridate |
| SMILES | O=C(Cl)ON1CCNC1=O |
| InChI | InChI=1S/C4H5ClN2O3/c5-3(8)10-7-2-1-6-4(7)9/h1-2H2,(H,6,9) |
| InChIKey | SRDRZXOZDOZPHI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.55 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoimidazolidin-1-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoimidazolidin-1-yl) carbonochloridate?
The IUPAC name of (2-oxoimidazolidin-1-yl) carbonochloridate (CID 88752032) is (2-oxoimidazolidin-1-yl) carbonochloridate.
What is the SMILES notation for (2-oxoimidazolidin-1-yl) carbonochloridate?
The canonical SMILES for (2-oxoimidazolidin-1-yl) carbonochloridate is O=C(Cl)ON1CCNC1=O.
What is the InChIKey of (2-oxoimidazolidin-1-yl) carbonochloridate?
The InChIKey is SRDRZXOZDOZPHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O3/c5-3(8)10-7-2-1-6-4(7)9/h1-2H2,(H,6,9).
What are the key properties of (2-oxoimidazolidin-1-yl) carbonochloridate?
(2-oxoimidazolidin-1-yl) carbonochloridate has a molecular weight of 164.55 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoimidazolidin-1-yl) carbonochloridate is sourced from PubChem (CID 88752032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).