C23H33N2O6P — CID 22838123
methyl (4S,7S)-7-[[ethoxy(3-phenylpropyl)phosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate (PubChem CID 22838123) has the molecular formula C23H33N2O6P and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl (4S,7S)-7-[[ethoxy(3-phenylpropyl)phosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate.
| Compound Name | methyl (4S,7S)-7-[[ethoxy(3-phenylpropyl)phosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
|---|---|
| PubChem CID | 22838123 |
| Molecular Formula | C23H33N2O6P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl (4S,7S)-7-[[ethoxy(3-phenylpropyl)phosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylate |
| SMILES | CCOP(=O)(CCCc1ccccc1)C[C@H]1CCC(=O)N2CCC[C@@H](C(=O)OC)N2C1=O |
| InChI | InChI=1S/C23H33N2O6P/c1-3-31-32(29,16-8-11-18-9-5-4-6-10-18)17-19-13-14-21(26)24-15-7-12-20(23(28)30-2)25(24)22(19)27/h4-6,9-10,19-20H,3,7-8,11-17H2,1-2H3/t19-,20+,32?/m1/s1 |
| InChIKey | HRHFMJQFJLVPSE-WTSOJDPFSA-N |
| XLogP | 3.25 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|