C20H28N3O6P — CID 22838093
(4S,7S)-7-[[2-(4-aminophenyl)ethyl-methoxyphosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid (PubChem CID 22838093) has the molecular formula C20H28N3O6P and a molecular weight of 437.43 g/mol. Its IUPAC name is (4S,7S)-7-[[2-(4-aminophenyl)ethyl-methoxyphosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid.
| Compound Name | (4S,7S)-7-[[2-(4-aminophenyl)ethyl-methoxyphosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 22838093 |
| Molecular Formula | C20H28N3O6P |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (4S,7S)-7-[[2-(4-aminophenyl)ethyl-methoxyphosphoryl]methyl]-6,10-dioxo-2,3,4,7,8,9-hexahydro-1H-pyridazino[1,2-a]diazepine-4-carboxylic acid |
| SMILES | COP(=O)(CCc1ccc(N)cc1)C[C@H]1CCC(=O)N2CCC[C@@H](C(=O)O)N2C1=O |
| InChI | InChI=1S/C20H28N3O6P/c1-29-30(28,12-10-14-4-7-16(21)8-5-14)13-15-6-9-18(24)22-11-2-3-17(20(26)27)23(22)19(15)25/h4-5,7-8,15,17H,2-3,6,9-13,21H2,1H3,(H,26,27)/t15-,17+,30?/m1/s1 |
| InChIKey | UGFBTOHUTWDYNG-TVHYEVSSSA-N |
| XLogP | 1.97 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|