C20H30NO6P — CID 131712757
methyl (2S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 131712757) has the molecular formula C20H30NO6P and a molecular weight of 411.44 g/mol. Its IUPAC name is methyl (2S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131712757 |
| Molecular Formula | C20H30NO6P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl (2S)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCOP(=O)(CCCCc1ccccc1)CC(=O)N1CC(O)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C20H30NO6P/c1-3-27-28(25,12-8-7-11-16-9-5-4-6-10-16)15-19(23)21-14-17(22)13-18(21)20(24)26-2/h4-6,9-10,17-18,22H,3,7-8,11-15H2,1-2H3/t17?,18-,28?/m0/s1 |
| InChIKey | JRWQDKBGLWDUMH-PBRZOGGKSA-N |
| XLogP | 2.46 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|