C20H28NO5PS2 — CID 14103105
[2-[(8S)-8-methoxycarbonyl-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid (PubChem CID 14103105) has the molecular formula C20H28NO5PS2 and a molecular weight of 457.55 g/mol. Its IUPAC name is [2-[(8S)-8-methoxycarbonyl-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid.
| Compound Name | [2-[(8S)-8-methoxycarbonyl-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 14103105 |
| Molecular Formula | C20H28NO5PS2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [2-[(8S)-8-methoxycarbonyl-1,4-dithia-7-azaspiro[4.4]nonan-7-yl]-2-oxoethyl]-(4-phenylbutyl)phosphinic acid |
| SMILES | COC(=O)[C@@H]1CC2(CN1C(=O)CP(=O)(O)CCCCc1ccccc1)SCCS2 |
| InChI | InChI=1S/C20H28NO5PS2/c1-26-19(23)17-13-20(28-11-12-29-20)15-21(17)18(22)14-27(24,25)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,17H,5-6,9-15H2,1H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | AFHXIFHDAARCOP-KRWDZBQOSA-N |
| XLogP | 3.23 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|